Hexyl 5-bromo-2-hydroxybenzoate
Modify Date: 2025-09-04 19:19:10
Hexyl 5-bromo-2-hydroxybenzoate structure
|
Common Name | Hexyl 5-bromo-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 100614-10-6 | Molecular Weight | 301.17600 | |
| Density | 1.342g/cm3 | Boiling Point | 345.089ºC at 760 mmHg | |
| Molecular Formula | C13H17BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.504ºC | |
| Name | Hexyl 5-bromo-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 345.089ºC at 760 mmHg |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.17600 |
| Flash Point | 162.504ºC |
| Exact Mass | 300.03600 |
| PSA | 46.53000 |
| LogP | 3.89180 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | PYHWRSPSOBAKFS-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)c1cc(Br)ccc1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 5-bromo-2-hydroxybenzoic acid hexyl ester |
| hexyl 5-bromanyl-2-oxidanyl-benzoate |