4-bromo-N-(4-chlorophenyl)-N-methylbenzenesulfonamide structure
|
Common Name | 4-bromo-N-(4-chlorophenyl)-N-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 100374-81-0 | Molecular Weight | 360.65400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-N-(4-chlorophenyl)-N-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11BrClNO2S |
|---|---|
| Molecular Weight | 360.65400 |
| Exact Mass | 358.93800 |
| PSA | 45.76000 |
| LogP | 5.00840 |
| InChIKey | RADMIBNHYAUTFV-UHFFFAOYSA-N |
| SMILES | CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Br)cc1 |
|
~%
4-bromo-N-(4-ch... CAS#:100374-81-0 |
| Literature: Neeman; Modiano Journal of Organic Chemistry, 1956 , vol. 21, p. 667,669 |
|
~%
4-bromo-N-(4-ch... CAS#:100374-81-0 |
| Literature: Neeman; Modiano Journal of Organic Chemistry, 1956 , vol. 21, p. 667,669 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-bromo-benzenesulfonic acid-(4-chloro-N-methyl-anilide) |
| N-(4-chlorophenyl)-N-methyl-4-bromo-benzenesulfonamide |
| 4-Brom-benzolsulfonsaeure-(4-chlor-N-methyl-anilid) |
| Benzenesulfonamide,4-bromo-N-(4-chlorophenyl)-N-methyl |