methyl 3-benzamido-4-oxopentanoate
Modify Date: 2025-11-16 11:16:33
methyl 3-benzamido-4-oxopentanoate structure
|
Common Name | methyl 3-benzamido-4-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 100373-13-5 | Molecular Weight | 249.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-benzamido-4-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO4 |
|---|---|
| Molecular Weight | 249.26200 |
| Exact Mass | 249.10000 |
| PSA | 75.96000 |
| LogP | 1.51190 |
| InChIKey | CLKFNPGWMPRGHS-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(NC(=O)c1ccccc1)C(C)=O |
|
~74%
methyl 3-benzam... CAS#:100373-13-5 |
| Literature: WO2005/40127 A1, ; Page/Page column 97 ; WO 2005/040127 A1 |
|
~%
methyl 3-benzam... CAS#:100373-13-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 10 p. 1853 - 1864 |
|
~%
methyl 3-benzam... CAS#:100373-13-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 10 p. 1853 - 1864 |
|
~%
methyl 3-benzam... CAS#:100373-13-5 |
| Literature: Journal of the Chemical Society, , p. 144,149 |
CAS#:103788-64-3
CAS#:103788-65-4
CAS#:107367-98-6| 3-Benzoylamino-4-oxo-valeriansaeure-methylester |
| 3-benzoylamino-4-oxo-valeric acid methyl ester |
| 3-benzoylamino-4-oxo-pentanoic acid methyl ester |
| Pentanoic acid,3-(benzoylamino)-4-oxo-,methyl ester |
| methyl 3-benzoylamino-4-oxopentanoate |
| methyl 3-benzamido-4-oxovalerate |