methyl 3-(5-methoxy-1H-indol-3-yl)propanoate
Modify Date: 2025-09-05 16:06:24
methyl 3-(5-methoxy-1H-indol-3-yl)propanoate structure
|
Common Name | methyl 3-(5-methoxy-1H-indol-3-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 100372-62-1 | Molecular Weight | 233.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(5-methoxy-1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO3 |
|---|---|
| Molecular Weight | 233.26300 |
| Exact Mass | 233.10500 |
| PSA | 51.32000 |
| LogP | 2.28210 |
| InChIKey | UJZCGIMHNVFNMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1c[nH]c2ccc(OC)cc12 |
|
~89%
methyl 3-(5-met... CAS#:100372-62-1 |
| Literature: PLEXXIKON, INC. Patent: WO2005/9958 A1, 2005 ; Location in patent: Page 95-96 ; WO 2005/009958 A1 |
|
~%
methyl 3-(5-met... CAS#:100372-62-1 |
| Literature: Eli Lilly and Company Patent: US5578634 A1, 1996 ; US 5578634 A |
|
~%
methyl 3-(5-met... CAS#:100372-62-1 |
| Literature: Barrett; Perkin; Robinson Journal of the Chemical Society, 1929 , p. 2945 |
| 3-(5-methoxy-1H-indol-3-yl)-propionic acid methyl ester |
| 3-(5-Methoxy-indol-3-yl)-propionsaeure-methylester |
| 1H-Indole-3-propanoic acid,5-methoxy-,methyl ester |
| 3-(5-methoxy-indol-3-yl)-propionic acid methyl ester |
| 5-methoxy-1H-indole-3-propanoic acid methyl ester |