N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline,N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)acetamide structure
|
Common Name | N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline,N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 100308-09-6 | Molecular Weight | 611.53400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H29Cl2FN4O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline,N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H29Cl2FN4O6S2 |
|---|---|
| Molecular Weight | 611.53400 |
| Exact Mass | 610.08900 |
| PSA | 133.38000 |
| LogP | 5.67470 |
| Vapour Pressure | 1.27E-05mmHg at 25°C |
| InChIKey | GGYMQVUBPCOEQZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)c1ccccc1.COCC(=O)N(c1c(C)cccc1C)N1CCOC1=O |
| Acetamide,N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-3-oxazolidinyl)-,mixt. with 1,1-dichloro-N-((dimethylamino)sulfonyl)-1-fluoro-N-phenylmethanesulfenamide |
| Oxadixyl mixed with dichlofluanid |
| Dichlofluanid-oxadixyl mixture |
| Dichlofluanid,mixt. with oxadixyl |