3,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1,10-phenanthroline structure
|
Common Name | 3,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1,10-phenanthroline | ||
|---|---|---|---|---|
| CAS Number | 1001330-07-9 | Molecular Weight | 460.52500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H16N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1,10-phenanthroline |
|---|
| Molecular Formula | C24H16N2O4S2 |
|---|---|
| Molecular Weight | 460.52500 |
| Exact Mass | 460.05500 |
| PSA | 119.18000 |
| LogP | 5.78240 |
| InChIKey | NNNJFZNRZQYNOQ-UHFFFAOYSA-N |
| SMILES | c1nc2c(ccc3cc(-c4scc5c4OCCO5)cnc32)cc1-c1scc2c1OCCO2 |
|
~53%
3,8-bis(2,3-dih... CAS#:1001330-07-9 |
| Literature: Chen, Xiao-Yan; Yang, Xiaoping; Holliday, Bradley J. Journal of the American Chemical Society, 2008 , vol. 130, # 5 p. 1546 - 1547 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |