4-phenyloxane-4-carbonyl chloride
Modify Date: 2025-09-16 13:28:37
4-phenyloxane-4-carbonyl chloride structure
|
Common Name | 4-phenyloxane-4-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 100119-45-7 | Molecular Weight | 224.68300 | |
| Density | 1.206g/cm3 | Boiling Point | 318.3ºC at 760mmHg | |
| Molecular Formula | C12H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.3ºC | |
| Name | 4-phenyloxane-4-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 318.3ºC at 760mmHg |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.68300 |
| Flash Point | 118.3ºC |
| Exact Mass | 224.06000 |
| PSA | 26.30000 |
| LogP | 2.50020 |
| Vapour Pressure | 0.000364mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | MNCVQLSKZIVCDW-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C1(c2ccccc2)CCOCC1 |
| HS Code | 2932999099 |
|---|
|
~%
4-phenyloxane-4... CAS#:100119-45-7 |
| Literature: Eisleb Chemische Berichte, 1941 , vol. 74, p. 1433,1449 |
|
~%
4-phenyloxane-4... CAS#:100119-45-7 |
| Literature: Eisleb Chemische Berichte, 1941 , vol. 74, p. 1433,1449 |
|
~%
4-phenyloxane-4... CAS#:100119-45-7 |
| Literature: Eisleb Chemische Berichte, 1941 , vol. 74, p. 1433,1449 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| F2190-0168 |
| 2H-Pyran-4-carbonylchloride,tetrahydro-4-phenyl |
| 4-Phenyltetrahydro-2H-pyran-4-carbonyl chloride |
| 4-Phenyl-tetrahydro-pyran-4-carbonylchlorid |
| 4-phenyl-tetrahydro-pyran-4-carbonyl chloride |