3-Bromo-2-methyl-5-nitroaniline
Modify Date: 2025-08-28 19:37:58
3-Bromo-2-methyl-5-nitroaniline structure
|
Common Name | 3-Bromo-2-methyl-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 1000342-34-6 | Molecular Weight | 231.047 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 367.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H7BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1±26.5 °C | |
| Name | 3-bromo-2-methyl-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.5±37.0 °C at 760 mmHg |
| Molecular Formula | C7H7BrN2O2 |
| Molecular Weight | 231.047 |
| Flash Point | 176.1±26.5 °C |
| Exact Mass | 229.969086 |
| PSA | 71.84000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | AORXQFQBVQILBL-UHFFFAOYSA-N |
| SMILES | Cc1c(N)cc([N+](=O)[O-])cc1Br |
| HS Code | 2921430090 |
|---|
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine, 3-bromo-2-methyl-5-nitro- |
| 3-Bromo-2-methyl-5-nitroaniline |
| 3-Bromo-2-methyl-5-nitroanilin |