54966-49-3
54966-49-3 structure
- Name: 4-Oxo-2-pentynoic acid ethyl ester
- Chemical Name: ethyl 4-oxopent-2-ynoate
- CAS Number: 54966-49-3
- Molecular Formula: C7H8O3
- Molecular Weight: 140.13700
- Create Date: 2017-05-09 11:42:31
- Modify Date: 2025-09-14 10:37:46
| Name | ethyl 4-oxopent-2-ynoate |
|---|---|
| Synonyms |
ethyl 3-acetylpropynoate
ethyl 4-oxo-pent-2-ynoate ethyl 3-oxo-1-butyne-1-carboxylate ethyl 4-oxo-2-pentynoate InChI=1/C7H8O3/c1-3-10-7(9)5-4-6(2)8/h3H2,1-2H 4-Oxo-2-pentynoic acid ethyl ester 2-Pentynoic acid,4-oxo-,ethyl ester |
| Molecular Formula | C7H8O3 |
|---|---|
| Molecular Weight | 140.13700 |
| Exact Mass | 140.04700 |
| PSA | 43.37000 |
| LogP | 0.14190 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |