| Name | bis(furan-2-yl)phosphinic acid |
|---|---|
| Synonyms |
Di-(2-furyl)-phosphinat
BIS(2-FURYL)PHOSPHINIC ACID di-furan-2-yl-phosphinic acid di-2-furanylphosphinic acid |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 425.2ºC at 760mmHg |
| Molecular Formula | C8H7O4P |
| Molecular Weight | 198.11300 |
| Flash Point | 210.9ºC |
| Exact Mass | 198.00800 |
| PSA | 73.39000 |
| LogP | 1.09380 |
| Index of Refraction | 1.558 |
|
~%
65887-64-1 |
| Literature: Clive; Kang Journal of Organic Chemistry, 2001 , vol. 66, # 18 p. 6083 - 6091 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |