| Name |
1-Methanesulfonyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine
|
| Molecular Formula |
C10H14N2O2S
|
| Molecular Weight |
226.30
|
| Smiles |
CS(=O)(=O)N1CCNCc2ccccc21
|
CS(=O)(=O)N1CCNCc2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.