| Name |
tert-butyl 3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}piperazine-1-carboxylate
|
| Molecular Formula |
C14H20N6O2
|
| Molecular Weight |
304.35
|
| Smiles |
CC(C)(C)OC(=O)N1CCNC(c2cnc3n[nH]nc3c2)C1
|
CC(C)(C)OC(=O)N1CCNC(c2cnc3n[nH]nc3c2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.