| Name |
1,1-Difluoro-2-{6-methylimidazo[2,1-b][1,3]thiazol-5-yl}propan-2-amine
|
| Molecular Formula |
C9H11F2N3S
|
| Molecular Weight |
231.27
|
| Smiles |
Cc1nc2sccn2c1C(C)(N)C(F)F
|
Cc1nc2sccn2c1C(C)(N)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.