| Name |
2-(but-3-yn-2-yl)-4,5,6,7-tetrahydro-1H-indole
|
| Molecular Formula |
C12H15N
|
| Molecular Weight |
173.25
|
| Smiles |
C#CC(C)c1cc2c([nH]1)CCCC2
|
C#CC(C)c1cc2c([nH]1)CCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.