| Name |
3-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetyl)-1,3-thiazolidine-4-carboxylic acid
|
| Molecular Formula |
C23H24N2O5S2
|
| Molecular Weight |
472.6
|
| Smiles |
O=C(NCCSCC(=O)N1CSCC1C(=O)O)OCC1c2ccccc2-c2ccccc21
|
O=C(NCCSCC(=O)N1CSCC1C(=O)O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.