| Name |
(R)-4-((5R,8R,9aS)-8-Amino-1-oxo-5-phenethylhexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)-5-((3,4-dichlorobenzyl)amino)-5-oxopentanoic acid
|
| Molecular Formula |
C28H34Cl2N4O4
|
| Molecular Weight |
561.5
|
| Smiles |
NC1CC2C(=O)N(C(CCC(=O)O)C(=O)NCc3ccc(Cl)c(Cl)c3)CCC(CCc3ccccc3)N2C1
|
NC1CC2C(=O)N(C(CCC(=O)O)C(=O)NCc3ccc(Cl)c(Cl)c3)CCC(CCc3ccccc3)N2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.