| Name |
3-Cyclopropyl-6,7-difluoro-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione
|
| Molecular Formula |
C22H23F2N3O3
|
| Molecular Weight |
415.4
|
| Smiles |
Cc1oc(-c2ccccc2)nc1CN1C(=O)N(C2CC2)C(=O)C2CC(F)C(F)CC21
|
Cc1oc(-c2ccccc2)nc1CN1C(=O)N(C2CC2)C(=O)C2CC(F)C(F)CC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.