| Name |
{Tricyclo[3.3.0.0,3,7]octan-1-yl}methanesulfonyl chloride
|
| Molecular Formula |
C9H13ClO2S
|
| Molecular Weight |
220.72
|
| Smiles |
O=S(=O)(Cl)CC12CC3CC1CC3C2
|
O=S(=O)(Cl)CC12CC3CC1CC3C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.