| Name |
(Z)-2-cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[4-methoxy-3-[3-(4-methylpiperazin-1-yl)propoxy]anilino]prop-2-enamide;propan-2-ol
|
| Molecular Formula |
C55H70Cl4N10O9
|
| Molecular Weight |
1157.0
|
| Smiles |
CC(C)O.COc1cc(NC(=O)C(C#N)=CNc2ccc(OC)c(OCCCN3CCN(C)CC3)c2)c(Cl)cc1Cl.COc1cc(NC(=O)C(C#N)=CNc2ccc(OC)c(OCCCN3CCN(C)CC3)c2)c(Cl)cc1Cl
|
CC(C)O.COc1cc(NC(=O)C(C#N)=CNc2ccc(OC)c(OCCCN3CCN(C)CC3)c2)c(Cl)cc1Cl.COc1cc(NC(=O)C(C#N)=CNc2ccc(OC)c(OCCCN3CCN(C)CC3)c2)c(Cl)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.