| Name |
3-{3-[(4-ethynylphenyl)amino]-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl}piperidine-2,6-dione
|
| Molecular Formula |
C17H13N3O4
|
| Molecular Weight |
323.30
|
| Smiles |
C#Cc1ccc(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)cc1
|
C#Cc1ccc(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.