| Name |
5-methyl-1-phenyl-1H-1,2,4-triazole-3-sulfonamide
|
| Molecular Formula |
C9H10N4O2S
|
| Molecular Weight |
238.27
|
| Smiles |
Cc1nc(S(N)(=O)=O)nn1-c1ccccc1
|
Cc1nc(S(N)(=O)=O)nn1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.