| Name |
1-{2,7-Dimethylpyrazolo[1,5-a]pyrimidin-6-yl}ethane-1-sulfonyl fluoride
|
| Molecular Formula |
C10H12FN3O2S
|
| Molecular Weight |
257.29
|
| Smiles |
Cc1cc2ncc(C(C)S(=O)(=O)F)c(C)n2n1
|
Cc1cc2ncc(C(C)S(=O)(=O)F)c(C)n2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.