| Name |
4-Amino-5-(3,5-dimethylpyrrol-2-yl)-4h-1,2,4-triazole-3-thiol
|
| Molecular Formula |
C8H11N5S
|
| Molecular Weight |
209.27
|
| Smiles |
Cc1cc(C)c(-c2n[nH]c(=S)n2N)[nH]1
|
Cc1cc(C)c(-c2n[nH]c(=S)n2N)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.