| Name |
Tert-butyl (3aR,6aS)-5-[[(3aR,6aS)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate
|
| Molecular Formula |
C24H41N3O4
|
| Molecular Weight |
435.6
|
| Smiles |
CC(C)(C)OC(=O)N1CC2CC(NC3CC4CN(C(=O)OC(C)(C)C)CC4C3)CC2C1
|
CC(C)(C)OC(=O)N1CC2CC(NC3CC4CN(C(=O)OC(C)(C)C)CC4C3)CC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.