| Name |
1-(4-chloro-2,5-dimethoxyphenyl)-1H-1,2,3-triazole-4-carboxylic acid
|
| Molecular Formula |
C11H10ClN3O4
|
| Molecular Weight |
283.67
|
| Smiles |
COc1cc(-n2cc(C(=O)O)nn2)c(OC)cc1Cl
|
COc1cc(-n2cc(C(=O)O)nn2)c(OC)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.