| Name |
5H-Indeno[2,1-c]quinoline-3-carboximidamide,6-(3-chlorophenyl)-6,6a,7,11b-tetrahydro-
|
| Molecular Formula |
C23H20ClN3
|
| Molecular Weight |
373.9
|
| Smiles |
N=C(N)c1ccc2c(c1)NC(c1cccc(Cl)c1)C1Cc3ccccc3C21
|
N=C(N)c1ccc2c(c1)NC(c1cccc(Cl)c1)C1Cc3ccccc3C21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.