| Name |
3-({[3-(3,5-Dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-6-[4-(propan-2-yl)phenyl]pyridazine
|
| Molecular Formula |
C24H24N4O3S
|
| Molecular Weight |
448.5
|
| Smiles |
COc1cc(OC)cc(-c2noc(CSc3ccc(-c4ccc(C(C)C)cc4)nn3)n2)c1
|
COc1cc(OC)cc(-c2noc(CSc3ccc(-c4ccc(C(C)C)cc4)nn3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.