| Name |
3-{3-[(Phenylsulfonyl)methyl]-1,2,4-oxadiazol-5-yl}propan-1-amine
|
| Molecular Formula |
C12H15N3O3S
|
| Molecular Weight |
281.33
|
| Smiles |
NCCCc1nc(CS(=O)(=O)c2ccccc2)no1
|
NCCCc1nc(CS(=O)(=O)c2ccccc2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.