| Name |
2,2'-(4,5-Dimethoxy-1,2-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)
|
| Molecular Formula |
C20H32B2O6
|
| Molecular Weight |
390.1
|
| Smiles |
COc1cc(B2OC(C)(C)C(C)(C)O2)c(B2OC(C)(C)C(C)(C)O2)cc1OC
|
COc1cc(B2OC(C)(C)C(C)(C)O2)c(B2OC(C)(C)C(C)(C)O2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.