| Name |
4-(methylsulfonyl)-N-(3-{[4-methyl-5-(thiophen-2-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}propyl)-2-nitroaniline
|
| Molecular Formula |
C17H19N5O4S3
|
| Molecular Weight |
453.6
|
| Smiles |
Cn1c(SCCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])nnc1-c1cccs1
|
Cn1c(SCCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])nnc1-c1cccs1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.