| Name |
(2Z,4E)-5-[(1R,3R,4R,5S,8S)-1,5-Dimethyl-3,4,8-trihydroxy-6-oxo-7-oxabicyclo[3.2.1]octane-8-yl]-3-methyl-2,4-pentadienoic acid
|
| Molecular Formula |
C15H20O7
|
| Molecular Weight |
312.31
|
| Smiles |
CC(C=CC1(O)C2(C)CC(O)C(O)C1(C)C(=O)O2)=CC(=O)O
|
CC(C=CC1(O)C2(C)CC(O)C(O)C1(C)C(=O)O2)=CC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.