| Name |
5-Ethyl-2,3,4,5-tetrahydropyrido[2,3-f][1,2,5]thiadiazepine 1,1-dioxide
|
| Molecular Formula |
C9H13N3O2S
|
| Molecular Weight |
227.29
|
| Smiles |
CCN1CCNS(=O)(=O)c2cccnc21
|
CCN1CCNS(=O)(=O)c2cccnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.