| Name |
8-Fluoro-2,9-dihydro-1H-pyrido[3,4-b]indol-1-one
|
| Molecular Formula |
C11H7FN2O
|
| Molecular Weight |
202.18
|
| Smiles |
O=c1[nH]ccc2c1[nH]c1c(F)cccc12
|
O=c1[nH]ccc2c1[nH]c1c(F)cccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.