| Name | O-(3-Chloro-1-phenyl-1H-pyrazol-5-yl) O-ethyl O-methyl ester phosphorothioic acid | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C11H12ClN2O3PS | 
                        
                        
                            | Molecular Weight | 318.72 | 
                        
                        
                            | Smiles | COP(=S)(OC)Oc1cc(Cl)nn1-c1ccccc1 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        COP(=S)(OC)Oc1cc(Cl)nn1-c1ccccc1
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.