| Name |
18-epi-3-Isoreserpic acid, O-(2-methoxyethyl)-, 2-methoxyethyl ester
|
| Molecular Formula |
C28H40N2O7
|
| Molecular Weight |
516.6
|
| Smiles |
COCCOC(=O)C1C2CC3c4[nH]c5cc(OC)ccc5c4CCN3CC2CC(OCCOC)C1OC
|
COCCOC(=O)C1C2CC3c4[nH]c5cc(OC)ccc5c4CCN3CC2CC(OCCOC)C1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.