| Name |
5-(2-Azabicyclo[2.1.1]hexan-5-yl)-N,N-dimethyl-1,3-oxazole-4-carboxamide;dihydrochloride
|
| Molecular Formula |
C11H17Cl2N3O2
|
| Molecular Weight |
294.17
|
| Smiles |
CN(C)C(=O)c1ncoc1C1C2CNC1C2.Cl.Cl
|
CN(C)C(=O)c1ncoc1C1C2CNC1C2.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.