| Name |
5'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclopentane-1,3'-indoline]
|
| Molecular Formula |
C18H26BNO2
|
| Molecular Weight |
299.2
|
| Smiles |
CC1(C)OB(c2ccc3c(c2)C2(CCCC2)CN3)OC1(C)C
|
CC1(C)OB(c2ccc3c(c2)C2(CCCC2)CN3)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.