| Name |
1'-ethyl-4'-nitro-1'H-1,3'-bipyrazole-3-carboxylic acid
|
| Molecular Formula |
C9H9N5O4
|
| Molecular Weight |
251.20
|
| Smiles |
CCn1cc([N+](=O)[O-])c(-n2ccc(C(=O)O)n2)n1
|
CCn1cc([N+](=O)[O-])c(-n2ccc(C(=O)O)n2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.