| Name |
5-(3,6-Dihydro-2H-pyran-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine
|
| Molecular Formula |
C11H12N4O
|
| Molecular Weight |
216.24
|
| Smiles |
Nc1nc2cccc(C3=CCOCC3)n2n1
|
Nc1nc2cccc(C3=CCOCC3)n2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.