| Name |
5-Ethyl-7-methyl-3H-pyrazolo[4,3-d][1,2,3]triazin-4(5H)-one
|
| Molecular Formula |
C7H9N5O
|
| Molecular Weight |
179.18
|
| Smiles |
CCn1nc(C)c2nn[nH]c(=O)c21
|
CCn1nc(C)c2nn[nH]c(=O)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.