| Name |
4-methoxy-2-(4-{1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperazin-1-yl)pyrimidine
|
| Molecular Formula |
C14H16N8O
|
| Molecular Weight |
312.33
|
| Smiles |
COc1ccnc(N2CCN(c3ncnc4[nH]ncc34)CC2)n1
|
COc1ccnc(N2CCN(c3ncnc4[nH]ncc34)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.