| Name |
3-{[4-({Imidazo[1,2-b]pyridazin-6-yloxy}methyl)piperidin-1-yl]sulfonyl}pyridine
|
| Molecular Formula |
C17H19N5O3S
|
| Molecular Weight |
373.4
|
| Smiles |
O=S(=O)(c1cccnc1)N1CCC(COc2ccc3nccn3n2)CC1
|
O=S(=O)(c1cccnc1)N1CCC(COc2ccc3nccn3n2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.