| Name |
2-Propenoic acid, 3-[4-fluoro-4a(2)-(trifluoromethoxy)[1,1a(2)-biphenyl]-3-yl]-
|
| Molecular Formula |
C16H10F4O3
|
| Molecular Weight |
326.24
|
| Smiles |
O=C(O)C=Cc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1F
|
O=C(O)C=Cc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.