| Name |
2-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)ethane-1-sulfonyl fluoride
|
| Molecular Formula |
C7H13FN4O2S
|
| Molecular Weight |
236.27
|
| Smiles |
CC(C)(C)n1nnc(CCS(=O)(=O)F)n1
|
CC(C)(C)n1nnc(CCS(=O)(=O)F)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.