| Name |
Benzyl (S)-4-(difluoromethyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide
|
| Molecular Formula |
C11H11F2NO5S
|
| Molecular Weight |
307.27
|
| Smiles |
O=C(OCc1ccccc1)N1C(C(F)F)COS1(=O)=O
|
O=C(OCc1ccccc1)N1C(C(F)F)COS1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.