| Name |
(4E)-1-(2,2,2-trifluoroacetyl)-1,2,3,6,7,8-hexahydroazocine-4-carboxylic acid
|
| Molecular Formula |
C10H12F3NO3
|
| Molecular Weight |
251.20
|
| Smiles |
O=C(O)C1=CCCCN(C(=O)C(F)(F)F)CC1
|
O=C(O)C1=CCCCN(C(=O)C(F)(F)F)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.