| Name |
6-Benzofuranol, 2,4,5,6,7,7a-hexahydro-2-[(1E,3E,5E,7E,9E,11E)-13-hydroxy-1,5,10-trimethyl-1,3,5,7,9,11-tridecahexaenyl]-4,4,7a-trimethyl-
|
| Molecular Formula |
C27H38O3
|
| Molecular Weight |
410.6
|
| Smiles |
CC(C=CC=C(C)C1C=C2C(C)(C)CC(O)CC2(C)O1)=CC=CC=C(C)C=CCO
|
CC(C=CC=C(C)C1C=C2C(C)(C)CC(O)CC2(C)O1)=CC=CC=C(C)C=CCO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.