| Name |
rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2S)-cyclobutane-1,2-dicarboxylate
|
| Molecular Formula |
C15H13NO6
|
| Molecular Weight |
303.27
|
| Smiles |
COC(=O)C1CCC1C(=O)ON1C(=O)c2ccccc2C1=O
|
COC(=O)C1CCC1C(=O)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.