| Name |
[1,1'-Biphenyl]-4-propanoic acid,-(acetylamino)-, (R)-, compd. with (S)--methylbenzenemethanamine (1:1)
|
| Molecular Formula |
C25H28N2O3
|
| Molecular Weight |
404.5
|
| Smiles |
CC(=O)NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O.CC(N)c1ccccc1
|
CC(=O)NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O.CC(N)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.