| Name |
N-(4,5-Dibromo-2-nitro-3,6-dioxo-1,4-cyclohexadien-1-yl)acetamide
|
| Molecular Formula |
C8H4Br2N2O5
|
| Molecular Weight |
367.94
|
| Smiles |
CC(=O)NC1=C([N+](=O)[O-])C(=O)C(Br)=C(Br)C1=O
|
CC(=O)NC1=C([N+](=O)[O-])C(=O)C(Br)=C(Br)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.